Model No.︰4006
Brand Name︰OEM service
Country of Origin︰China
Unit Price︰-
Minimum Order︰-
| product Name | 2-Aminopurine |
|---|---|
| Synonyms | 1H-Purin-2-amine; CCRIS 759; NSC 24129; SQ 22451; Purine, 2-amino-; 7H-purin-2-amine; 5H-purin-2-amine |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.1267 |
| InChI | InChI=1/C5H5N5/c6-5-7-1-3-4(10-5)9-2-8-3/h1-3H,(H2,6,8,9,10) |
| CAS Registry Number | 452-06-2 |
| EINECS | 207-197-4 |
| Molecular Structure | 
|
| Density | 1.89g/cm3 |
| Melting point | 280-284℃ |
| Boiling point | 293.5°C at 760 mmHg |
| Refractive index | 1.954 |
| Flash point | 131.3°C |
| Vapour Pressur | 0.00172mmHg at 25°C |
| Hazard Symbols |  Xn:Harmful;
|
| Risk Codes | R22:;
|
| Safety Description | S22:;
S36:; |
Specifications︰
Product Name: 2-Aminopurine
Assay: 98.0 to 101.0%
